C20H19ClN2O3S — CID 142713463
methyl 2-[2-[4-(chloromethyl)benzoyl]imino-1,3-benzothiazol-3-yl]butanoate (PubChem CID 142713463) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is methyl 2-[2-[4-(chloromethyl)benzoyl]imino-1,3-benzothiazol-3-yl]butanoate.
| Compound Name | methyl 2-[2-[4-(chloromethyl)benzoyl]imino-1,3-benzothiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 142713463 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | methyl 2-[2-[4-(chloromethyl)benzoyl]imino-1,3-benzothiazol-3-yl]butanoate |
| SMILES | CCC(C(=O)OC)n1/c(=N/C(=O)c2ccc(CCl)cc2)sc2ccccc21 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-3-15(19(25)26-2)23-16-6-4-5-7-17(16)27-20(23)22-18(24)14-10-8-13(12-21)9-11-14/h4-11,15H,3,12H2,1-2H3/b22-20- |
| InChIKey | FMCPOMLPQRNPFA-XDOYNYLZSA-N |
| XLogP | 4.31 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|