C27H25N3O4S — CID 142713261
methyl 2-[5-benzamido-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate (PubChem CID 142713261) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl 2-[5-benzamido-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate.
| Compound Name | methyl 2-[5-benzamido-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 142713261 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | methyl 2-[5-benzamido-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
| SMILES | CCC(C(=O)OC)n1/c(=N/C(=O)c2ccc(C)cc2)sc2ccc(NC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C27H25N3O4S/c1-4-21(26(33)34-3)30-22-16-20(28-24(31)18-8-6-5-7-9-18)14-15-23(22)35-27(30)29-25(32)19-12-10-17(2)11-13-19/h5-16,21H,4H2,1-3H3,(H,28,31)/b29-27- |
| InChIKey | AQUTXSREERFKII-OHYPFYFLSA-N |
| XLogP | 5.13 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |