C20H21N3O3S — CID 89461417
methyl 2-[6-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate (PubChem CID 89461417) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl 2-[6-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate.
| Compound Name | methyl 2-[6-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 89461417 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 2-[6-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
| SMILES | CCC(C(=O)OC)n1/c(=N/C(=O)c2ccc(C)cc2)sc2cc(N)ccc21 |
| InChI | InChI=1S/C20H21N3O3S/c1-4-15(19(25)26-3)23-16-10-9-14(21)11-17(16)27-20(23)22-18(24)13-7-5-12(2)6-8-13/h5-11,15H,4,21H2,1-3H3/b22-20- |
| InChIKey | IHYCTFVJISTFDW-XDOYNYLZSA-N |
| XLogP | 3.46 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|