C19H18N3O3S- — CID 131741772
2-[5-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate (PubChem CID 131741772) has the molecular formula C19H18N3O3S- and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[5-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate.
| Compound Name | 2-[5-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 131741772 |
| Molecular Formula | C19H18N3O3S- |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[5-amino-2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]butanoate |
| SMILES | CCC(C(=O)[O-])n1/c(=N/C(=O)c2ccc(C)cc2)sc2ccc(N)cc21 |
| InChI | InChI=1S/C19H19N3O3S/c1-3-14(18(24)25)22-15-10-13(20)8-9-16(15)26-19(22)21-17(23)12-6-4-11(2)5-7-12/h4-10,14H,3,20H2,1-2H3,(H,24,25)/p-1/b21-19- |
| InChIKey | KFUHIAADUCOQIY-VZCXRCSSSA-M |
| XLogP | 2.04 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|