C20H17N3O3S — CID 71542677
2-[2-(1H-indole-5-carbonylimino)-1,3-benzothiazol-3-yl]butanoic acid (PubChem CID 71542677) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[2-(1H-indole-5-carbonylimino)-1,3-benzothiazol-3-yl]butanoic acid.
| Compound Name | 2-[2-(1H-indole-5-carbonylimino)-1,3-benzothiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 71542677 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[2-(1H-indole-5-carbonylimino)-1,3-benzothiazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1/c(=N/C(=O)c2ccc3[nH]ccc3c2)sc2ccccc21 |
| InChI | InChI=1S/C20H17N3O3S/c1-2-15(19(25)26)23-16-5-3-4-6-17(16)27-20(23)22-18(24)13-7-8-14-12(11-13)9-10-21-14/h3-11,15,21H,2H2,1H3,(H,25,26)/b22-20- |
| InChIKey | CQPFPCNKVBZJNF-XDOYNYLZSA-N |
| XLogP | 3.96 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |