C20H19ClN2O3S — CID 89461943
2-[2-(3-chlorobenzoyl)imino-5,6-dimethyl-1,3-benzothiazol-3-yl]butanoic acid (PubChem CID 89461943) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-[2-(3-chlorobenzoyl)imino-5,6-dimethyl-1,3-benzothiazol-3-yl]butanoic acid.
| Compound Name | 2-[2-(3-chlorobenzoyl)imino-5,6-dimethyl-1,3-benzothiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 89461943 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[2-(3-chlorobenzoyl)imino-5,6-dimethyl-1,3-benzothiazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1/c(=N/C(=O)c2cccc(Cl)c2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-4-15(19(25)26)23-16-8-11(2)12(3)9-17(16)27-20(23)22-18(24)13-6-5-7-14(21)10-13/h5-10,15H,4H2,1-3H3,(H,25,26)/b22-20- |
| InChIKey | FXZIYXBDKZOYCI-XDOYNYLZSA-N |
| XLogP | 4.75 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |