About O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine
O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine (PubChem CID 89466320) has the molecular formula C11H28N2O3
and a molecular weight of 236.36 g/mol. Its IUPAC name is O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine.
Molecular Properties
| Compound Name | O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine |
| PubChem CID | 89466320 |
| Molecular Formula | C11H28N2O3 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine |
| SMILES | CCCCC(C)ON.COC(C)OC(C)N |
| InChI | InChI=1S/C6H15NO.C5H13NO2/c1-3-4-5-6(2)8-7;1-4(6)8-5(2)7-3/h6H,3-5,7H2,1-2H3;4-5H,6H2,1-3H3 |
| InChIKey | ULOLFWBQCLLXTP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine?
The IUPAC name of O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine (CID 89466320) is O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine.
What is the SMILES notation for O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine?
The canonical SMILES for O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine is CCCCC(C)ON.COC(C)OC(C)N.
What is the InChIKey of O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine?
The InChIKey is ULOLFWBQCLLXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.C5H13NO2/c1-3-4-5-6(2)8-7;1-4(6)8-5(2)7-3/h6H,3-5,7H2,1-2H3;4-5H,6H2,1-3H3.
What are the key properties of O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine?
O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine has a molecular weight of 236.36 g/mol, XLogP of 1.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-hexan-2-ylhydroxylamine;1-(1-methoxyethoxy)ethanamine is sourced from PubChem (CID 89466320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).