About (6S)-6-aminooxyheptane-1,1-diol
(6S)-6-aminooxyheptane-1,1-diol (PubChem CID 163412308) has the molecular formula C7H17NO3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (6S)-6-aminooxyheptane-1,1-diol.
Molecular Properties
| Compound Name | (6S)-6-aminooxyheptane-1,1-diol |
| PubChem CID | 163412308 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (6S)-6-aminooxyheptane-1,1-diol |
| SMILES | C[C@@H](CCCCC(O)O)ON |
| InChI | InChI=1S/C7H17NO3/c1-6(11-8)4-2-3-5-7(9)10/h6-7,9-10H,2-5,8H2,1H3/t6-/m0/s1 |
| InChIKey | ABNJNNCUJNEUGO-LURJTMIESA-N |
| XLogP | 0.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6S)-6-aminooxyheptane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-aminooxyheptane-1,1-diol?
The IUPAC name of (6S)-6-aminooxyheptane-1,1-diol (CID 163412308) is (6S)-6-aminooxyheptane-1,1-diol.
What is the SMILES notation for (6S)-6-aminooxyheptane-1,1-diol?
The canonical SMILES for (6S)-6-aminooxyheptane-1,1-diol is C[C@@H](CCCCC(O)O)ON.
What is the InChIKey of (6S)-6-aminooxyheptane-1,1-diol?
The InChIKey is ABNJNNCUJNEUGO-LURJTMIESA-N. The full InChI is InChI=1S/C7H17NO3/c1-6(11-8)4-2-3-5-7(9)10/h6-7,9-10H,2-5,8H2,1H3/t6-/m0/s1.
What are the key properties of (6S)-6-aminooxyheptane-1,1-diol?
(6S)-6-aminooxyheptane-1,1-diol has a molecular weight of 163.22 g/mol, XLogP of 0.14, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-aminooxyheptane-1,1-diol is sourced from PubChem (CID 163412308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).