C22H27N3O4 — CID 89468590
3-[4-[[2,2-dimethyl-5-(2-methyliminohydrazinyl)-3H-1-benzofuran-7-yl]methoxy]phenyl]-2-methylpropanoic acid (PubChem CID 89468590) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[4-[[2,2-dimethyl-5-(2-methyliminohydrazinyl)-3H-1-benzofuran-7-yl]methoxy]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[[2,2-dimethyl-5-(2-methyliminohydrazinyl)-3H-1-benzofuran-7-yl]methoxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 89468590 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[4-[[2,2-dimethyl-5-(2-methyliminohydrazinyl)-3H-1-benzofuran-7-yl]methoxy]phenyl]-2-methylpropanoic acid |
| SMILES | C/N=N/Nc1cc(COc2ccc(CC(C)C(=O)O)cc2)c2c(c1)CC(C)(C)O2 |
| InChI | InChI=1S/C22H27N3O4/c1-14(21(26)27)9-15-5-7-19(8-6-15)28-13-17-11-18(24-25-23-4)10-16-12-22(2,3)29-20(16)17/h5-8,10-11,14H,9,12-13H2,1-4H3,(H,23,24)(H,26,27) |
| InChIKey | ZETXLJURBFCJDF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|