About 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid
3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid (PubChem CID 58566466) has the molecular formula C21H23ClO4
and a molecular weight of 374.86 g/mol. Its IUPAC name is 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid |
| PubChem CID | 58566466 |
| Molecular Formula | C21H23ClO4 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(OCc2c(Cl)ccc3c2CC(C)(C)O3)cc1)C(=O)O |
| InChI | InChI=1S/C21H23ClO4/c1-13(20(23)24)10-14-4-6-15(7-5-14)25-12-17-16-11-21(2,3)26-19(16)9-8-18(17)22/h4-9,13H,10-12H2,1-3H3,(H,23,24) |
| InChIKey | HXLYFUAJNFNALR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid?
The IUPAC name of 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid (CID 58566466) is 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid?
The canonical SMILES for 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid is CC(Cc1ccc(OCc2c(Cl)ccc3c2CC(C)(C)O3)cc1)C(=O)O.
What is the InChIKey of 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid?
The InChIKey is HXLYFUAJNFNALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClO4/c1-13(20(23)24)10-14-4-6-15(7-5-14)25-12-17-16-11-21(2,3)26-19(16)9-8-18(17)22/h4-9,13H,10-12H2,1-3H3,(H,23,24).
What are the key properties of 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid?
3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid has a molecular weight of 374.86 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(5-chloro-2,2-dimethyl-3H-1-benzofuran-4-yl)methoxy]phenyl]-2-methylpropanoic acid is sourced from PubChem (CID 58566466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).