C54H46N2 — CID 89468798
3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,12(16),14,17,19-nonaene (PubChem CID 89468798) has the molecular formula C54H46N2 and a molecular weight of 722.98 g/mol. Its IUPAC name is 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,12(16),14,17,19-nonaene.
| Compound Name | 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,12(16),14,17,19-nonaene |
|---|---|
| PubChem CID | 89468798 |
| Molecular Formula | C54H46N2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.37 |
| IUPAC Name | 3,13-bis(9,9-dimethylfluoren-2-yl)-4,5,14,15-tetramethyl-3,13-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),4,7,9,12(16),14,17,19-nonaene |
| SMILES | Cc1c2c(n(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c1C)C1C=Cc3cc4c(C)c(C)n(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)c4c4c3C1C(=C2)C=C4 |
| InChI | InChI=1S/C54H46N2/c1-29-31(3)55(35-19-23-39-37-13-9-11-15-45(37)53(5,6)47(39)27-35)51-41-21-18-34-26-44-30(2)32(4)56(52(44)42-22-17-33(25-43(29)51)49(41)50(34)42)36-20-24-40-38-14-10-12-16-46(38)54(7,8)48(40)28-36/h9-28,41,49H,1-8H3 |
| InChIKey | PGRBOKIQHNQJLP-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |