C21H26N2O7 — CID 8947098
[(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (5S,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 8947098) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (5S,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (5S,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 8947098 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (5S,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)C23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N2O7/c1-12(18(24)22-16-4-3-15(29-2)6-17(16)23(27)28)30-19(25)20-7-13-5-14(8-20)10-21(26,9-13)11-20/h3-4,6,12-14,26H,5,7-11H2,1-2H3,(H,22,24)/t12-,13-,14+,20?,21?/m0/s1 |
| InChIKey | KQEGJZQHHIPCID-OJSIAMRESA-N |
| XLogP | 2.80 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|