C19H28N2O4S — CID 89472649
(3S)-3-[(3-oct-1-ynylphenyl)sulfamoylamino]pentanoic acid (PubChem CID 89472649) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is (3S)-3-[(3-oct-1-ynylphenyl)sulfamoylamino]pentanoic acid.
| Compound Name | (3S)-3-[(3-oct-1-ynylphenyl)sulfamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 89472649 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (3S)-3-[(3-oct-1-ynylphenyl)sulfamoylamino]pentanoic acid |
| SMILES | CCCCCCC#Cc1cccc(NS(=O)(=O)N[C@@H](CC)CC(=O)O)c1 |
| InChI | InChI=1S/C19H28N2O4S/c1-3-5-6-7-8-9-11-16-12-10-13-18(14-16)21-26(24,25)20-17(4-2)15-19(22)23/h10,12-14,17,20-21H,3-8,15H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | HGMYGRUWWOIGGO-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|