C15H16N5O4P — CID 89475341
(4R)-3-[(3S)-1-azidophosphanyl-5-oxopyrrolidine-3-carbonyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 89475341) has the molecular formula C15H16N5O4P and a molecular weight of 361.30 g/mol. Its IUPAC name is (4R)-3-[(3S)-1-azidophosphanyl-5-oxopyrrolidine-3-carbonyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3S)-1-azidophosphanyl-5-oxopyrrolidine-3-carbonyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89475341 |
| Molecular Formula | C15H16N5O4P |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (4R)-3-[(3S)-1-azidophosphanyl-5-oxopyrrolidine-3-carbonyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NPN1C[C@@H](C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C15H16N5O4P/c16-17-18-25-19-8-11(7-13(19)21)14(22)20-12(9-24-15(20)23)6-10-4-2-1-3-5-10/h1-5,11-12,25H,6-9H2/t11-,12+/m0/s1 |
| InChIKey | DVUPGJMJFNDZSZ-NWDGAFQWSA-N |
| XLogP | 2.24 |
| TPSA | 115.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|