C10H24O4Si3 — CID 89476034
1-[[[acetyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]ethanone (PubChem CID 89476034) has the molecular formula C10H24O4Si3 and a molecular weight of 292.56 g/mol. Its IUPAC name is 1-[[[acetyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]ethanone.
| Compound Name | 1-[[[acetyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]ethanone |
|---|---|
| PubChem CID | 89476034 |
| Molecular Formula | C10H24O4Si3 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[[[acetyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]ethanone |
| SMILES | CC(=O)[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C(C)=O |
| InChI | InChI=1S/C10H24O4Si3/c1-9(11)15(3,4)13-17(7,8)14-16(5,6)10(2)12/h1-8H3 |
| InChIKey | OQXQOHYKFXQOCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|