C10H28O5Si4 — CID 152618393
[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methylsilyl] acetate (PubChem CID 152618393) has the molecular formula C10H28O5Si4 and a molecular weight of 340.67 g/mol. Its IUPAC name is [[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methylsilyl] acetate.
| Compound Name | [[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methylsilyl] acetate |
|---|---|
| PubChem CID | 152618393 |
| Molecular Formula | C10H28O5Si4 |
| Molecular Weight | 340.67 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methylsilyl] acetate |
| SMILES | CC(=O)O[SiH](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H28O5Si4/c1-10(11)12-16(2)13-18(6,7)15-19(8,9)14-17(3,4)5/h16H,1-9H3 |
| InChIKey | ZAZULFIZQJOXQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.67 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|