C13H34O5Si4 — CID 175053326
dimethylsilyloxy-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;2-methylprop-2-enoic acid (PubChem CID 175053326) has the molecular formula C13H34O5Si4 and a molecular weight of 382.75 g/mol. Its IUPAC name is dimethylsilyloxy-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;2-methylprop-2-enoic acid.
| Compound Name | dimethylsilyloxy-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175053326 |
| Molecular Formula | C13H34O5Si4 |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | dimethylsilyloxy-[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilane;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C[SiH](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H28O3Si4.C4H6O2/c1-13(2)10-15(6,7)12-16(8,9)11-14(3,4)5;1-3(2)4(5)6/h13H,1-9H3;1H2,2H3,(H,5,6) |
| InChIKey | IFHPLDHRLKKKRH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|