About 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane
2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane (PubChem CID 158276188) has the molecular formula C11H28O4Si3
and a molecular weight of 308.60 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane |
| PubChem CID | 158276188 |
| Molecular Formula | C11H28O4Si3 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane |
| SMILES | C=C(C)C(=O)O.C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C7H22O2Si3.C4H6O2/c1-10(8-11(2,3)4)9-12(5,6)7;1-3(2)4(5)6/h10H,1-7H3;1H2,2H3,(H,5,6) |
| InChIKey | GJQCWVFBSQDZIZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane?
The IUPAC name of 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane (CID 158276188) is 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane.
What is the SMILES notation for 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane?
The canonical SMILES for 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane is C=C(C)C(=O)O.C[SiH](O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane?
The InChIKey is GJQCWVFBSQDZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H22O2Si3.C4H6O2/c1-10(8-11(2,3)4)9-12(5,6)7;1-3(2)4(5)6/h10H,1-7H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane?
2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane has a molecular weight of 308.60 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane is sourced from PubChem (CID 158276188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).