C16H30O3Si2 — CID 123150910
2,6-dimethyl-4-[methyl(trimethylsilyloxy)silyl]-4-propylhepta-1,6-diene-3,5-dione (PubChem CID 123150910) has the molecular formula C16H30O3Si2 and a molecular weight of 326.59 g/mol. Its IUPAC name is 2,6-dimethyl-4-[methyl(trimethylsilyloxy)silyl]-4-propylhepta-1,6-diene-3,5-dione.
| Compound Name | 2,6-dimethyl-4-[methyl(trimethylsilyloxy)silyl]-4-propylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123150910 |
| Molecular Formula | C16H30O3Si2 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2,6-dimethyl-4-[methyl(trimethylsilyloxy)silyl]-4-propylhepta-1,6-diene-3,5-dione |
| SMILES | C=C(C)C(=O)C(CCC)(C(=O)C(=C)C)[SiH](C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H30O3Si2/c1-10-11-16(14(17)12(2)3,15(18)13(4)5)20(6)19-21(7,8)9/h20H,2,4,10-11H2,1,3,5-9H3 |
| InChIKey | WDGKJGYCBPVIJF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|