C23H52O9Si6 — CID 123245733
[1-[bis(trimethylsilyloxy)silyloxy-bis(trimethylsilyloxy)silyl]-1-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 123245733) has the molecular formula C23H52O9Si6 and a molecular weight of 641.18 g/mol. Its IUPAC name is [1-[bis(trimethylsilyloxy)silyloxy-bis(trimethylsilyloxy)silyl]-1-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [1-[bis(trimethylsilyloxy)silyloxy-bis(trimethylsilyloxy)silyl]-1-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123245733 |
| Molecular Formula | C23H52O9Si6 |
| Molecular Weight | 641.18 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | [1-[bis(trimethylsilyloxy)silyloxy-bis(trimethylsilyloxy)silyl]-1-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)(OC(=O)C(=C)C)[Si](O[SiH](O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H52O9Si6/c1-18-23(26-21(24)19(2)3,27-22(25)20(4)5)38(31-36(12,13)14,32-37(15,16)17)30-33(28-34(6,7)8)29-35(9,10)11/h33H,2,4,18H2,1,3,5-17H3 |
| InChIKey | NLDLRAIJQUVNLB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.18 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|