C10H14O5 — CID 97052188
(2R)-2-ethyl-2-(2-methylprop-2-enoyloxy)-3-oxobutanoic acid (PubChem CID 97052188) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2R)-2-ethyl-2-(2-methylprop-2-enoyloxy)-3-oxobutanoic acid.
| Compound Name | (2R)-2-ethyl-2-(2-methylprop-2-enoyloxy)-3-oxobutanoic acid |
|---|---|
| PubChem CID | 97052188 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2R)-2-ethyl-2-(2-methylprop-2-enoyloxy)-3-oxobutanoic acid |
| SMILES | C=C(C)C(=O)O[C@](CC)(C(C)=O)C(=O)O |
| InChI | InChI=1S/C10H14O5/c1-5-10(7(4)11,9(13)14)15-8(12)6(2)3/h2,5H2,1,3-4H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | DRSGERPSZLWPHE-SNVBAGLBSA-N |
| XLogP | 0.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|