C15H26F6O3Si2 — CID 18739240
[5-[dimethyl(trimethylsilyloxy)silyl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 18739240) has the molecular formula C15H26F6O3Si2 and a molecular weight of 424.53 g/mol. Its IUPAC name is [5-[dimethyl(trimethylsilyloxy)silyl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [5-[dimethyl(trimethylsilyloxy)silyl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18739240 |
| Molecular Formula | C15H26F6O3Si2 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [5-[dimethyl(trimethylsilyloxy)silyl]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC[Si](C)(C)O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H26F6O3Si2/c1-11(2)12(22)23-13(14(16,17)18,15(19,20)21)9-8-10-26(6,7)24-25(3,4)5/h1,8-10H2,2-7H3 |
| InChIKey | JCNIDTJUOUGTLA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|