C19H44O6Si3 — CID 157170433
2-methylprop-2-enoic acid;6-[methyl(trimethylsilyloxy)silyl]-3-(2-trimethylsilylethyl)hexane-1,2,3-triol (PubChem CID 157170433) has the molecular formula C19H44O6Si3 and a molecular weight of 452.81 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;6-[methyl(trimethylsilyloxy)silyl]-3-(2-trimethylsilylethyl)hexane-1,2,3-triol.
| Compound Name | 2-methylprop-2-enoic acid;6-[methyl(trimethylsilyloxy)silyl]-3-(2-trimethylsilylethyl)hexane-1,2,3-triol |
|---|---|
| PubChem CID | 157170433 |
| Molecular Formula | C19H44O6Si3 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-methylprop-2-enoic acid;6-[methyl(trimethylsilyloxy)silyl]-3-(2-trimethylsilylethyl)hexane-1,2,3-triol |
| SMILES | C=C(C)C(=O)O.C[SiH](CCCC(O)(CC[Si](C)(C)C)C(O)CO)O[Si](C)(C)C |
| InChI | InChI=1S/C15H38O4Si3.C4H6O2/c1-20(19-22(5,6)7)11-8-9-15(18,14(17)13-16)10-12-21(2,3)4;1-3(2)4(5)6/h14,16-18,20H,8-13H2,1-7H3;1H2,2H3,(H,5,6) |
| InChIKey | ANKBUSKLTJBJCJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|