C17H40O7Si3 — CID 175064821
2-methylprop-2-enoic acid;3-(3-methylsilylpropoxy)-3,3-bis(trimethylsilyloxy)propane-1,2-diol (PubChem CID 175064821) has the molecular formula C17H40O7Si3 and a molecular weight of 440.76 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;3-(3-methylsilylpropoxy)-3,3-bis(trimethylsilyloxy)propane-1,2-diol.
| Compound Name | 2-methylprop-2-enoic acid;3-(3-methylsilylpropoxy)-3,3-bis(trimethylsilyloxy)propane-1,2-diol |
|---|---|
| PubChem CID | 175064821 |
| Molecular Formula | C17H40O7Si3 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-methylprop-2-enoic acid;3-(3-methylsilylpropoxy)-3,3-bis(trimethylsilyloxy)propane-1,2-diol |
| SMILES | C=C(C)C(=O)O.C[SiH2]CCCOC(O[Si](C)(C)C)(O[Si](C)(C)C)C(O)CO |
| InChI | InChI=1S/C13H34O5Si3.C4H6O2/c1-19-10-8-9-16-13(12(15)11-14,17-20(2,3)4)18-21(5,6)7;1-3(2)4(5)6/h12,14-15H,8-11,19H2,1-7H3;1H2,2H3,(H,5,6) |
| InChIKey | WVHARDKQBGMWAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|