C12H29NO3Si — CID 89476397
N,N-dimethyl-2-[2-[2-(trimethylsilylmethoxy)ethoxy]ethoxy]ethanamine (PubChem CID 89476397) has the molecular formula C12H29NO3Si and a molecular weight of 263.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[2-(trimethylsilylmethoxy)ethoxy]ethoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-[2-(trimethylsilylmethoxy)ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 89476397 |
| Molecular Formula | C12H29NO3Si |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N,N-dimethyl-2-[2-[2-(trimethylsilylmethoxy)ethoxy]ethoxy]ethanamine |
| SMILES | CN(C)CCOCCOCCOC[Si](C)(C)C |
| InChI | InChI=1S/C12H29NO3Si/c1-13(2)6-7-14-8-9-15-10-11-16-12-17(3,4)5/h6-12H2,1-5H3 |
| InChIKey | SWXGHSKYLRNZJF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|