C29H39N2O9+ — CID 89477718
3-[4-[2-[4-(1-adamantyl)phenoxy]acetyl]-1-methylpiperazin-1-ium-1-yl]oxycarbonyl-3-hydroxypentanedioic acid (PubChem CID 89477718) has the molecular formula C29H39N2O9+ and a molecular weight of 559.64 g/mol. Its IUPAC name is 3-[4-[2-[4-(1-adamantyl)phenoxy]acetyl]-1-methylpiperazin-1-ium-1-yl]oxycarbonyl-3-hydroxypentanedioic acid.
| Compound Name | 3-[4-[2-[4-(1-adamantyl)phenoxy]acetyl]-1-methylpiperazin-1-ium-1-yl]oxycarbonyl-3-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 89477718 |
| Molecular Formula | C29H39N2O9+ |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 3-[4-[2-[4-(1-adamantyl)phenoxy]acetyl]-1-methylpiperazin-1-ium-1-yl]oxycarbonyl-3-hydroxypentanedioic acid |
| SMILES | C[N+]1(OC(=O)C(O)(CC(=O)O)CC(=O)O)CCN(C(=O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)CC1 |
| InChI | InChI=1S/C29H38N2O9/c1-31(40-27(37)29(38,16-25(33)34)17-26(35)36)8-6-30(7-9-31)24(32)18-39-23-4-2-22(3-5-23)28-13-19-10-20(14-28)12-21(11-19)15-28/h2-5,19-21,38H,6-18H2,1H3,(H-,33,34,35,36)/p+1 |
| InChIKey | HEBPBJWEGUTNJP-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|