C27H36N2O6 — CID 131735379
2-[4-(1-adamantyl)phenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 131735379) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)phenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 2-[4-(1-adamantyl)phenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 131735379 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[4-(1-adamantyl)phenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[NH+]1CCN(C(=O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)CC1.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C23H32N2O2.C4H4O4/c1-24-6-8-25(9-7-24)22(26)16-27-21-4-2-20(3-5-21)23-13-17-10-18(14-23)12-19(11-17)15-23;5-3(6)1-2-4(7)8/h2-5,17-19H,6-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OROCMTBNYMWXDV-WLHGVMLRSA-N |
| XLogP | 0.27 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|