C20H26ClF4N3O3S — CID 89482447
3-chloro-N-[[1-(4-ethylsulfonylpiperazin-1-yl)-4,4-difluorocyclohexyl]methyl]-2,6-difluorobenzamide (PubChem CID 89482447) has the molecular formula C20H26ClF4N3O3S and a molecular weight of 499.96 g/mol. Its IUPAC name is 3-chloro-N-[[1-(4-ethylsulfonylpiperazin-1-yl)-4,4-difluorocyclohexyl]methyl]-2,6-difluorobenzamide.
| Compound Name | 3-chloro-N-[[1-(4-ethylsulfonylpiperazin-1-yl)-4,4-difluorocyclohexyl]methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 89482447 |
| Molecular Formula | C20H26ClF4N3O3S |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3-chloro-N-[[1-(4-ethylsulfonylpiperazin-1-yl)-4,4-difluorocyclohexyl]methyl]-2,6-difluorobenzamide |
| SMILES | CCS(=O)(=O)N1CCN(C2(CNC(=O)c3c(F)ccc(Cl)c3F)CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C20H26ClF4N3O3S/c1-2-32(30,31)28-11-9-27(10-12-28)19(5-7-20(24,25)8-6-19)13-26-18(29)16-15(22)4-3-14(21)17(16)23/h3-4H,2,5-13H2,1H3,(H,26,29) |
| InChIKey | ALKLCODNZDMOAP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|