C21H25ClF4N5O3S+ — CID 123214031
2-chloro-N-[[4,4-difluoro-1-[4-[(2-methylidene-3H-diazet-2-ium-4-yl)sulfonyl]piperazin-1-yl]cyclohexyl]methyl]-4,5-difluorobenzamide (PubChem CID 123214031) has the molecular formula C21H25ClF4N5O3S+ and a molecular weight of 538.98 g/mol. Its IUPAC name is 2-chloro-N-[[4,4-difluoro-1-[4-[(2-methylidene-3H-diazet-2-ium-4-yl)sulfonyl]piperazin-1-yl]cyclohexyl]methyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[[4,4-difluoro-1-[4-[(2-methylidene-3H-diazet-2-ium-4-yl)sulfonyl]piperazin-1-yl]cyclohexyl]methyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 123214031 |
| Molecular Formula | C21H25ClF4N5O3S+ |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 2-chloro-N-[[4,4-difluoro-1-[4-[(2-methylidene-3H-diazet-2-ium-4-yl)sulfonyl]piperazin-1-yl]cyclohexyl]methyl]-4,5-difluorobenzamide |
| SMILES | C=[N+]1CC(S(=O)(=O)N2CCN(C3(CNC(=O)c4cc(F)c(F)cc4Cl)CCC(F)(F)CC3)CC2)=N1 |
| InChI | InChI=1S/C21H24ClF4N5O3S/c1-29-12-18(28-29)35(33,34)31-8-6-30(7-9-31)20(2-4-21(25,26)5-3-20)13-27-19(32)14-10-16(23)17(24)11-15(14)22/h10-11H,1-9,12-13H2/p+1 |
| InChIKey | ZKKKLOAGUYMZJJ-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|