C18H18F2O5 — CID 89482793
2-[2-[4-[(2,5-difluorophenyl)methoxy]-3-methoxyphenyl]ethoxy]acetic acid (PubChem CID 89482793) has the molecular formula C18H18F2O5 and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[2-[4-[(2,5-difluorophenyl)methoxy]-3-methoxyphenyl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(2,5-difluorophenyl)methoxy]-3-methoxyphenyl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 89482793 |
| Molecular Formula | C18H18F2O5 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[2-[4-[(2,5-difluorophenyl)methoxy]-3-methoxyphenyl]ethoxy]acetic acid |
| SMILES | COc1cc(CCOCC(=O)O)ccc1OCc1cc(F)ccc1F |
| InChI | InChI=1S/C18H18F2O5/c1-23-17-8-12(6-7-24-11-18(21)22)2-5-16(17)25-10-13-9-14(19)3-4-15(13)20/h2-5,8-9H,6-7,10-11H2,1H3,(H,21,22) |
| InChIKey | XFZDKHBVXJRSAN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|