C13H13BrN2O3 — CID 89489409
N-[(3-bromophenyl)methyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489409) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489409 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CN1CC(C(=O)NCc2cccc(Br)c2)=C(O)C1=O |
| InChI | InChI=1S/C13H13BrN2O3/c1-16-7-10(11(17)13(16)19)12(18)15-6-8-3-2-4-9(14)5-8/h2-5,17H,6-7H2,1H3,(H,15,18) |
| InChIKey | NZNKGSKNIKACPE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |