C15H24S2 — CID 89489466
3-(cyclohexylmethylsulfanyl)-5,5-dimethylcyclohex-2-ene-1-thione (PubChem CID 89489466) has the molecular formula C15H24S2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 3-(cyclohexylmethylsulfanyl)-5,5-dimethylcyclohex-2-ene-1-thione.
| Compound Name | 3-(cyclohexylmethylsulfanyl)-5,5-dimethylcyclohex-2-ene-1-thione |
|---|---|
| PubChem CID | 89489466 |
| Molecular Formula | C15H24S2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-(cyclohexylmethylsulfanyl)-5,5-dimethylcyclohex-2-ene-1-thione |
| SMILES | CC1(C)CC(=S)C=C(SCC2CCCCC2)C1 |
| InChI | InChI=1S/C15H24S2/c1-15(2)9-13(16)8-14(10-15)17-11-12-6-4-3-5-7-12/h8,12H,3-7,9-11H2,1-2H3 |
| InChIKey | CZPSDYVJEAEHLJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|