C22H23Cl2NO5S — CID 89490596
[(2S)-2-[(2R,3R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-cyclopropylethyl] methanesulfonate (PubChem CID 89490596) has the molecular formula C22H23Cl2NO5S and a molecular weight of 484.40 g/mol. Its IUPAC name is [(2S)-2-[(2R,3R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-cyclopropylethyl] methanesulfonate.
| Compound Name | [(2S)-2-[(2R,3R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-cyclopropylethyl] methanesulfonate |
|---|---|
| PubChem CID | 89490596 |
| Molecular Formula | C22H23Cl2NO5S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | [(2S)-2-[(2R,3R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-cyclopropylethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](C1CC1)N1C(=O)CO[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2NO5S/c1-31(27,28)30-12-19(14-5-6-14)25-20(26)13-29-22(16-3-2-4-18(24)11-16)21(25)15-7-9-17(23)10-8-15/h2-4,7-11,14,19,21-22H,5-6,12-13H2,1H3/t19-,21-,22-/m1/s1 |
| InChIKey | NGTUMBXLNUXZNT-CEMLEFRQSA-N |
| XLogP | 4.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|