C27H35Cl2NO3Si — CID 163845594
(6R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)morpholin-3-one (PubChem CID 163845594) has the molecular formula C27H35Cl2NO3Si and a molecular weight of 520.57 g/mol. Its IUPAC name is (6R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)morpholin-3-one.
| Compound Name | (6R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)morpholin-3-one |
|---|---|
| PubChem CID | 163845594 |
| Molecular Formula | C27H35Cl2NO3Si |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (6R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)morpholin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C1CC1)N1C(=O)CO[C@H](c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H35Cl2NO3Si/c1-27(2,3)34(4,5)33-16-23(18-9-10-18)30-24(31)17-32-26(20-7-6-8-22(29)15-20)25(30)19-11-13-21(28)14-12-19/h6-8,11-15,18,23,25-26H,9-10,16-17H2,1-5H3/t23?,25?,26-/m1/s1 |
| InChIKey | OPWDCCXVGNVGKB-QDQFNNJSSA-N |
| XLogP | 7.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|