C41H45Cl2NO3Si — CID 90341468
(2R,5R,6R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-2-prop-2-enylmorpholin-3-one (PubChem CID 90341468) has the molecular formula C41H45Cl2NO3Si and a molecular weight of 698.81 g/mol. Its IUPAC name is (2R,5R,6R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-2-prop-2-enylmorpholin-3-one.
| Compound Name | (2R,5R,6R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 90341468 |
| Molecular Formula | C41H45Cl2NO3Si |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 697.25 |
| IUPAC Name | (2R,5R,6R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CC[C@@]1(C)O[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2CC2)C1=O |
| InChI | InChI=1S/C41H45Cl2NO3Si/c1-6-26-41(5)39(45)44(37(30-22-24-32(42)25-23-30)38(47-41)31-14-13-15-33(43)27-31)36(29-20-21-29)28-46-48(40(2,3)4,34-16-9-7-10-17-34)35-18-11-8-12-19-35/h6-19,22-25,27,29,36-38H,1,20-21,26,28H2,2-5H3/t36-,37-,38-,41-/m1/s1 |
| InChIKey | HIBKGDXSKIKCIZ-VBQUSUMGSA-N |
| XLogP | 9.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|