C37H41Cl2NO3Si — CID 174193087
(6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-hydroxypiperidin-2-one (PubChem CID 174193087) has the molecular formula C37H41Cl2NO3Si and a molecular weight of 646.73 g/mol. Its IUPAC name is (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-hydroxypiperidin-2-one.
| Compound Name | (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 174193087 |
| Molecular Formula | C37H41Cl2NO3Si |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-hydroxypiperidin-2-one |
| SMILES | CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)C(O)CC(c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H41Cl2NO3Si/c1-5-30(25-43-44(37(2,3)4,31-15-8-6-9-16-31)32-17-10-7-11-18-32)40-35(26-19-21-28(38)22-20-26)33(24-34(41)36(40)42)27-13-12-14-29(39)23-27/h6-23,30,33-35,41H,5,24-25H2,1-4H3/t30?,33?,34?,35-/m1/s1 |
| InChIKey | IKZFKUJIUSNABQ-ADVMGXBTSA-N |
| XLogP | 7.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|