C39H43Cl2NO4Si — CID 175130250
(3S,5R,6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carboxylic acid (PubChem CID 175130250) has the molecular formula C39H43Cl2NO4Si and a molecular weight of 688.77 g/mol. Its IUPAC name is (3S,5R,6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carboxylic acid.
| Compound Name | (3S,5R,6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175130250 |
| Molecular Formula | C39H43Cl2NO4Si |
| Molecular Weight | 688.77 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | (3S,5R,6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carboxylic acid |
| SMILES | CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)[C@@](C)(C(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C39H43Cl2NO4Si/c1-6-31(26-46-47(38(2,3)4,32-16-9-7-10-17-32)33-18-11-8-12-19-33)42-35(27-20-22-29(40)23-21-27)34(28-14-13-15-30(41)24-28)25-39(5,36(42)43)37(44)45/h7-24,31,34-35H,6,25-26H2,1-5H3,(H,44,45)/t31?,34-,35-,39+/m1/s1 |
| InChIKey | OCFCSIQODQCBNJ-JBLNKBRQSA-N |
| XLogP | 8.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.77 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|