C39H45Cl2NO2Si — CID 174193399
(6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one (PubChem CID 174193399) has the molecular formula C39H45Cl2NO2Si and a molecular weight of 658.79 g/mol. Its IUPAC name is (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one.
| Compound Name | (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one |
|---|---|
| PubChem CID | 174193399 |
| Molecular Formula | C39H45Cl2NO2Si |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | (6S)-1-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one |
| SMILES | CCC1CC(c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C39H45Cl2NO2Si/c1-6-28-26-36(30-15-14-16-32(41)25-30)37(29-21-23-31(40)24-22-29)42(38(28)43)33(7-2)27-44-45(39(3,4)5,34-17-10-8-11-18-34)35-19-12-9-13-20-35/h8-25,28,33,36-37H,6-7,26-27H2,1-5H3/t28?,33?,36?,37-/m1/s1 |
| InChIKey | BQHGJBBBFDBXSE-VTIPWCEDSA-N |
| XLogP | 9.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|