C40H45Cl2NO2Si — CID 67999090
(5R,6S)-1-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one (PubChem CID 67999090) has the molecular formula C40H45Cl2NO2Si and a molecular weight of 670.80 g/mol. Its IUPAC name is (5R,6S)-1-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one.
| Compound Name | (5R,6S)-1-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one |
|---|---|
| PubChem CID | 67999090 |
| Molecular Formula | C40H45Cl2NO2Si |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | (5R,6S)-1-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-cyclopropylethyl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-ethylpiperidin-2-one |
| SMILES | CCC1C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2CC2)C1=O |
| InChI | InChI=1S/C40H45Cl2NO2Si/c1-5-28-26-36(31-13-12-14-33(42)25-31)38(30-21-23-32(41)24-22-30)43(39(28)44)37(29-19-20-29)27-45-46(40(2,3)4,34-15-8-6-9-16-34)35-17-10-7-11-18-35/h6-18,21-25,28-29,36-38H,5,19-20,26-27H2,1-4H3/t28?,36-,37-,38-/m1/s1 |
| InChIKey | WISXZZZIZZPYGT-AYTURYNKSA-N |
| XLogP | 9.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|