C39H43Cl2NO3Si — CID 89481919
1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carbaldehyde (PubChem CID 89481919) has the molecular formula C39H43Cl2NO3Si and a molecular weight of 672.77 g/mol. Its IUPAC name is 1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carbaldehyde.
| Compound Name | 1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 89481919 |
| Molecular Formula | C39H43Cl2NO3Si |
| Molecular Weight | 672.77 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | 1-[(2R)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxopiperidine-3-carbaldehyde |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)C(C)(C=O)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C39H43Cl2NO3Si/c1-28(23-24-45-46(38(2,3)4,33-15-8-6-9-16-33)34-17-10-7-11-18-34)42-36(29-19-21-31(40)22-20-29)35(26-39(5,27-43)37(42)44)30-13-12-14-32(41)25-30/h6-22,25,27-28,35-36H,23-24,26H2,1-5H3/t28-,35?,36?,39?/m1/s1 |
| InChIKey | VASWTUYQEUTVHU-HANXOWLJSA-N |
| XLogP | 8.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|