C37H41Cl2NO2Si — CID 89481374
(3R,5R,6S)-3-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)piperidin-2-one (PubChem CID 89481374) has the molecular formula C37H41Cl2NO2Si and a molecular weight of 630.73 g/mol. Its IUPAC name is (3R,5R,6S)-3-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)piperidin-2-one.
| Compound Name | (3R,5R,6S)-3-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 89481374 |
| Molecular Formula | C37H41Cl2NO2Si |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | (3R,5R,6S)-3-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-5-(3-chlorophenyl)-6-(4-chlorophenyl)piperidin-2-one |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C37H41Cl2NO2Si/c1-26(22-23-42-43(37(2,3)4,31-14-7-5-8-15-31)32-16-9-6-10-17-32)33-25-34(28-12-11-13-30(39)24-28)35(40-36(33)41)27-18-20-29(38)21-19-27/h5-21,24,26,33-35H,22-23,25H2,1-4H3,(H,40,41)/t26-,33+,34+,35+/m0/s1 |
| InChIKey | HRMLPLOHOSIOMU-BINWWWHHSA-N |
| XLogP | 8.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|