C40H45Cl2NO4Si- — CID 163524299
CID 163524299 (PubChem CID 163524299) has the molecular formula C40H45Cl2NO4Si- and a molecular weight of 702.80 g/mol.
| Compound Name | CID 163524299 |
|---|---|
| PubChem CID | 163524299 |
| Molecular Formula | C40H45Cl2NO4Si- |
| Molecular Weight | 702.80 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | — |
| SMILES | CCC(CO[Si-](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)C(CC(=O)OC)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C40H45Cl2NO4Si/c1-6-33(27-47-48(40(2,3)4,34-16-9-7-10-17-34)35-18-11-8-12-19-35)43-38(28-20-22-31(41)23-21-28)36(29-14-13-15-32(42)24-29)25-30(39(43)45)26-37(44)46-5/h7-24,30,33,36,38H,6,25-27H2,1-5H3/q-1/t30?,33?,36-,38-/m1/s1 |
| InChIKey | KTAHLJYAVDQKJS-JEKNBMQDSA-N |
| XLogP | 8.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|