C25H27ClN4O2S2 — CID 89491514
2-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(4-chlorophenyl)furan-3-yl]propyl]guanidine (PubChem CID 89491514) has the molecular formula C25H27ClN4O2S2 and a molecular weight of 515.10 g/mol. Its IUPAC name is 2-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(4-chlorophenyl)furan-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(4-chlorophenyl)furan-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 89491514 |
| Molecular Formula | C25H27ClN4O2S2 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(4-chlorophenyl)furan-3-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCc1cc(-c2ccc(Cl)cc2)oc1/C=C1\SC(=S)N(C2CC3CCC2C3)C1=O |
| InChI | InChI=1S/C25H27ClN4O2S2/c26-18-7-5-15(6-8-18)20-12-17(2-1-9-29-24(27)28)21(32-20)13-22-23(31)30(25(33)34-22)19-11-14-3-4-16(19)10-14/h5-8,12-14,16,19H,1-4,9-11H2,(H4,27,28,29)/b22-13- |
| InChIKey | XEGCZVZFVPZQSH-XKZIYDEJSA-N |
| XLogP | 5.20 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|