C26H28ClNO2S3 — CID 89491605
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-hydroxypentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491605) has the molecular formula C26H28ClNO2S3 and a molecular weight of 518.17 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-hydroxypentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-hydroxypentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491605 |
| Molecular Formula | C26H28ClNO2S3 |
| Molecular Weight | 518.17 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-hydroxypentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(CCCCCO)c(-c3ccc(Cl)cc3)s2)SC(=S)N1C1CC2CCC1C2 |
| InChI | InChI=1S/C26H28ClNO2S3/c27-20-9-7-17(8-10-20)24-19(4-2-1-3-11-29)14-21(32-24)15-23-25(30)28(26(31)33-23)22-13-16-5-6-18(22)12-16/h7-10,14-16,18,22,29H,1-6,11-13H2/b23-15- |
| InChIKey | PFCYXQHYOMSPIQ-HAHDFKILSA-N |
| XLogP | 7.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.17 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|