C27H33N3O2S2 — CID 123162389
5-[[3-(5-aminopentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123162389) has the molecular formula C27H33N3O2S2 and a molecular weight of 495.71 g/mol. Its IUPAC name is 5-[[3-(5-aminopentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-(5-aminopentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123162389 |
| Molecular Formula | C27H33N3O2S2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 5-[[3-(5-aminopentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(-c2cc(CCCCCN)c(C=C3SC(=S)N(C4CC5CCC4C5)C3=O)[nH]2)c1 |
| InChI | InChI=1S/C27H33N3O2S2/c1-32-21-8-5-7-18(14-21)22-15-19(6-3-2-4-11-28)23(29-22)16-25-26(31)30(27(33)34-25)24-13-17-9-10-20(24)12-17/h5,7-8,14-17,20,24,29H,2-4,6,9-13,28H2,1H3 |
| InChIKey | UWGFNISANVGQJC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|