C30H36Cl2N4OS2 — CID 89493194
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-3-[5-(4-chloropiperazin-1-yl)pentyl]-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89493194) has the molecular formula C30H36Cl2N4OS2 and a molecular weight of 603.69 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-3-[5-(4-chloropiperazin-1-yl)pentyl]-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-3-[5-(4-chloropiperazin-1-yl)pentyl]-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89493194 |
| Molecular Formula | C30H36Cl2N4OS2 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-3-[5-(4-chloropiperazin-1-yl)pentyl]-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2[nH]c(-c3ccc(Cl)cc3)cc2CCCCCN2CCN(Cl)CC2)SC(=S)N1C1CC2CCC1C2 |
| InChI | InChI=1S/C30H36Cl2N4OS2/c31-24-9-7-21(8-10-24)25-18-22(4-2-1-3-11-34-12-14-35(32)15-13-34)26(33-25)19-28-29(37)36(30(38)39-28)27-17-20-5-6-23(27)16-20/h7-10,18-20,23,27,33H,1-6,11-17H2/b28-19- |
| InChIKey | QGKCBBQDUHRECG-USHMODERSA-N |
| XLogP | 7.21 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|