C31H37ClN2OS3 — CID 89491508
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-piperidin-1-ylpentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491508) has the molecular formula C31H37ClN2OS3 and a molecular weight of 585.30 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-piperidin-1-ylpentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-piperidin-1-ylpentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491508 |
| Molecular Formula | C31H37ClN2OS3 |
| Molecular Weight | 585.30 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(4-chlorophenyl)-4-(5-piperidin-1-ylpentyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(CCCCCN3CCCCC3)c(-c3ccc(Cl)cc3)s2)SC(=S)N1C1CC2CCC1C2 |
| InChI | InChI=1S/C31H37ClN2OS3/c32-25-12-10-22(11-13-25)29-24(7-3-1-4-14-33-15-5-2-6-16-33)19-26(37-29)20-28-30(35)34(31(36)38-28)27-18-21-8-9-23(27)17-21/h10-13,19-21,23,27H,1-9,14-18H2/b28-20- |
| InChIKey | JTPYABARYJZXRT-RRAHZORUSA-N |
| XLogP | 8.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.30 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|