C27H21Cl2NOS3 — CID 89491568
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[3,5-bis(4-chlorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491568) has the molecular formula C27H21Cl2NOS3 and a molecular weight of 542.58 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[3,5-bis(4-chlorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[3,5-bis(4-chlorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491568 |
| Molecular Formula | C27H21Cl2NOS3 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[3,5-bis(4-chlorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2sc(-c3ccc(Cl)cc3)cc2-c2ccc(Cl)cc2)SC(=S)N1C1CC2CCC1C2 |
| InChI | InChI=1S/C27H21Cl2NOS3/c28-19-7-3-16(4-8-19)21-13-23(17-5-9-20(29)10-6-17)33-24(21)14-25-26(31)30(27(32)34-25)22-12-15-1-2-18(22)11-15/h3-10,13-15,18,22H,1-2,11-12H2/b25-14- |
| InChIKey | PFUZZSGFSOFGON-QFEZKATASA-N |
| XLogP | 8.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|