C31H31ClN2O2S2 — CID 89491656
(5Z)-5-[[1-benzyl-5-(4-chlorophenyl)-4-(3-hydroxypropyl)pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491656) has the molecular formula C31H31ClN2O2S2 and a molecular weight of 563.19 g/mol. Its IUPAC name is (5Z)-5-[[1-benzyl-5-(4-chlorophenyl)-4-(3-hydroxypropyl)pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-benzyl-5-(4-chlorophenyl)-4-(3-hydroxypropyl)pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491656 |
| Molecular Formula | C31H31ClN2O2S2 |
| Molecular Weight | 563.19 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (5Z)-5-[[1-benzyl-5-(4-chlorophenyl)-4-(3-hydroxypropyl)pyrrol-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(CCCO)c(-c3ccc(Cl)cc3)n2Cc2ccccc2)SC(=S)N1C1CC2CCC1C2 |
| InChI | InChI=1S/C31H31ClN2O2S2/c32-25-12-10-22(11-13-25)29-24(7-4-14-35)17-26(33(29)19-20-5-2-1-3-6-20)18-28-30(36)34(31(37)38-28)27-16-21-8-9-23(27)15-21/h1-3,5-6,10-13,17-18,21,23,27,35H,4,7-9,14-16,19H2/b28-18- |
| InChIKey | MFFNGZXBKYNWJH-VEILYXNESA-N |
| XLogP | 7.17 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.19 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|