C31H39N3O5S2 — CID 88875650
5-amino-N-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]pentanamide (PubChem CID 88875650) has the molecular formula C31H39N3O5S2 and a molecular weight of 597.80 g/mol. Its IUPAC name is 5-amino-N-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]pentanamide.
| Compound Name | 5-amino-N-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]pentanamide |
|---|---|
| PubChem CID | 88875650 |
| Molecular Formula | C31H39N3O5S2 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 5-amino-N-[3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]pentanamide |
| SMILES | COc1cc(OC)cc(-c2cc(CCCNC(=O)CCCCN)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C31H39N3O5S2/c1-37-23-14-22(15-24(17-23)38-2)26-16-21(6-5-11-33-29(35)7-3-4-10-32)27(39-26)18-28-30(36)34(31(40)41-28)25-13-19-8-9-20(25)12-19/h14-20,25H,3-13,32H2,1-2H3,(H,33,35)/b28-18- |
| InChIKey | OBJUTETVZBKXMM-VEILYXNESA-N |
| XLogP | 5.53 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|